ChemNet > CAS > 5731-01-1 4'-(4-bromophenyl)acetophenone
5731-01-1 4'-(4-bromophenyl)acetophenone
| product Name |
4'-(4-bromophenyl)acetophenone |
| CAS No |
5731-01-1 |
| Synonyms |
Acetylbromodiphenyl; 4-Acetyl-4-bromodiphenyl; 1-(4'-bromobiphenyl-4-yl)ethanone; 4'-Bromo-4-acetylbiphenyl; 4-Acetyl-4'-bromobiphenyl |
| Molecular Formula |
C14H11BrO |
| Molecular Weight |
275.1405 |
| InChI |
InChI=1/C14H11BrO/c1-10(16)11-2-4-12(5-3-11)13-6-8-14(15)9-7-13/h2-9H,1H3 |
| EINECS |
227-236-9 |
| Molecular Structure |
|
| Density |
1.359g/cm3 |
| Boiling point |
372.1°C at 760 mmHg |
| Refractive index |
1.592 |
| Flash point |
76.7°C |
| Vapour Pressur |
9.83E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
