ChemNet > CAS > 5735-41-1 2-(Hydroxymethyl)benzeneboronic acid cyclic monoester
5735-41-1 2-(Hydroxymethyl)benzeneboronic acid cyclic monoester
| product Name |
2-(Hydroxymethyl)benzeneboronic acid cyclic monoester |
| CAS No |
5735-41-1 |
| Synonyms |
1-Hydroxy-2,1-benzoxaborolane~2-(Hydroxymethyl)phenylboronic acid cyclic monoester; 2-(Hydroxymethyl)phenylboronic acid cyclic monoester; 2,1-benzoxaborol-1(3H)-ol; [2-(hydroxymethyl)phenyl]boronic acid |
| Molecular Formula |
C7H9BO3 |
| Molecular Weight |
151.9556 |
| InChI |
InChI=1/C7H9BO3/c9-5-6-3-1-2-4-7(6)8(10)11/h1-4,9-11H,5H2 |
| Molecular Structure |
|
| Density |
1.25g/cm3 |
| Melting point |
95-100℃ |
| Boiling point |
379.8°C at 760 mmHg |
| Refractive index |
1.566 |
| Flash point |
183.5°C |
| Vapour Pressur |
1.92E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
