5736-91-4 p-Pentyloxybenzaldehyde
product Name |
p-Pentyloxybenzaldehyde |
CAS No |
5736-91-4 |
Synonyms |
4-pentyloxybenzaldehyde; 4-n-pentyloxybenzaldehyde |
Molecular Formula |
C12H16O2 |
Molecular Weight |
192.2542 |
InChI |
InChI=1/C12H16O2/c1-2-3-4-9-14-12-7-5-11(10-13)6-8-12/h5-8,10H,2-4,9H2,1H3 |
EINECS |
227-250-5 |
Molecular Structure |
|
Density |
1.005g/cm3 |
Boiling point |
303.6°C at 760 mmHg |
Refractive index |
1.521 |
Flash point |
129°C |
Vapour Pressur |
0.000923mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|