ChemNet > CAS > 5736-91-4 p-Pentyloxybenzaldehyde
5736-91-4 p-Pentyloxybenzaldehyde
| product Name |
p-Pentyloxybenzaldehyde |
| CAS No |
5736-91-4 |
| Synonyms |
4-pentyloxybenzaldehyde; 4-n-pentyloxybenzaldehyde |
| Molecular Formula |
C12H16O2 |
| Molecular Weight |
192.2542 |
| InChI |
InChI=1/C12H16O2/c1-2-3-4-9-14-12-7-5-11(10-13)6-8-12/h5-8,10H,2-4,9H2,1H3 |
| EINECS |
227-250-5 |
| Molecular Structure |
|
| Density |
1.005g/cm3 |
| Boiling point |
303.6°C at 760 mmHg |
| Refractive index |
1.521 |
| Flash point |
129°C |
| Vapour Pressur |
0.000923mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
