ChemNet > CAS > 5743-34-0 D-gluconic acid, cyclic 4,5-ester with boric acid, calcium salt (2:1)
5743-34-0 D-gluconic acid, cyclic 4,5-ester with boric acid, calcium salt (2:1)
| product Name |
D-gluconic acid, cyclic 4,5-ester with boric acid, calcium salt (2:1) |
| CAS No |
5743-34-0 |
| Synonyms |
Calcium borogluconate; AI3-52160; D-Gluconic acid, cyclic 4,5-ester with boric acid, calcium salt (2:1); calcium bis{2,3-dihydroxy-3-[2-hydroxy-5-(hydroxymethyl)-1,3,2-dioxaborolan-4-yl]propanoate}; 2,3-dihydroxy-3-[2-hydroxy-5-(hydroxymethyl)-1,3,2-dioxaborolan-4-yl]propanoic acid |
| Molecular Formula |
C6H11BO8 |
| Molecular Weight |
221.9577 |
| InChI |
InChI=1/C6H11BO8/c8-1-2-5(15-7(13)14-2)3(9)4(10)6(11)12/h2-5,8-10,13H,1H2,(H,11,12) |
| EINECS |
227-264-1 |
| Molecular Structure |
|
| Density |
1.68g/cm3 |
| Boiling point |
530.9°C at 760 mmHg |
| Refractive index |
1.558 |
| Flash point |
274.9°C |
| Vapour Pressur |
1.73E-13mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
