ChemNet > CAS > 57455-06-8 3-Iodobenzyl alcohol
57455-06-8 3-Iodobenzyl alcohol
| product Name |
3-Iodobenzyl alcohol |
| CAS No |
57455-06-8 |
| Synonyms |
Benzyl alcohol, m-iodo-; BRN 3234821; Benzenemethanol, 3-iodo-; m-Iodobenzyl alcohol; (3-iodophenyl)methanol |
| Molecular Formula |
C7H7IO |
| Molecular Weight |
234.0343 |
| InChI |
InChI=1/C7H7IO/c8-7-3-1-2-6(4-7)5-9/h1-4,9H,5H2 |
| EINECS |
260-744-9 |
| Molecular Structure |
|
| Density |
1.867g/cm3 |
| Boiling point |
254.7°C at 760 mmHg |
| Refractive index |
1.648 |
| Flash point |
129.8°C |
| Vapour Pressur |
0.00881mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
