ChemNet > CAS > 575-43-9 1,6-Dimethylnaphthalene
575-43-9 1,6-Dimethylnaphthalene
| product Name |
1,6-Dimethylnaphthalene |
| CAS No |
575-43-9 |
| Synonyms |
AI3-17608; HSDB 6024; NSC 52966; Naphthalene, 1,6-dimethyl-; Naphthalene, 1,6-dimethyl- (8CI)(9CI) |
| Molecular Formula |
C12H12 |
| Molecular Weight |
156.2237 |
| InChI |
InChI=1/C12H12/c1-9-6-7-12-10(2)4-3-5-11(12)8-9/h3-8H,1-2H3 |
| EINECS |
209-385-1 |
| Molecular Structure |
|
| Density |
1g/cm3 |
| Boiling point |
264.4°C at 760 mmHg |
| Refractive index |
1.604 |
| Flash point |
110.5°C |
| Vapour Pressur |
0.0159mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
