ChemNet > CAS > 5751-82-6 Ethyl 5-chlorothiophene-2-carboxylate
5751-82-6 Ethyl 5-chlorothiophene-2-carboxylate
| product Name |
Ethyl 5-chlorothiophene-2-carboxylate |
| CAS No |
5751-82-6 |
| Synonyms |
5-Chlorothiophene-2-carboxylic acid ethyl ester; Ethyl 5-chlorothiophene-2-carboxlate;
|
| Molecular Formula |
C7H7ClO2S |
| Molecular Weight |
190.6473 |
| InChI |
InChI=1/C7H7ClO2S/c1-2-10-7(9)5-3-4-6(8)11-5/h3-4H,2H2,1H3 |
| Molecular Structure |
|
| Density |
1.312g/cm3 |
| Boiling point |
253.7°C at 760 mmHg |
| Refractive index |
1.545 |
| Flash point |
107.3°C |
| Vapour Pressur |
0.018mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/38:Irritating to eyes and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
