ChemNet > CAS > 57598-33-1 2-(2-methoxyphenyl)-4,4-dimethyl-2-oxazoline
57598-33-1 2-(2-methoxyphenyl)-4,4-dimethyl-2-oxazoline
| product Name |
2-(2-methoxyphenyl)-4,4-dimethyl-2-oxazoline |
| CAS No |
57598-33-1 |
| Synonyms |
2-(2-Methoxyphenyl)-4,4-dimethyl-4,5-dihydro-1,3-oxazole; NSC 333420 |
| Molecular Formula |
C12H15NO2 |
| Molecular Weight |
205.253 |
| InChI |
InChI=1/C12H15NO2/c1-12(2)8-15-11(13-12)9-6-4-5-7-10(9)14-3/h4-7H,8H2,1-3H3 |
| Molecular Structure |
|
| Density |
1.08g/cm3 |
| Melting point |
71-74℃ |
| Boiling point |
311.5°C at 760 mmHg |
| Refractive index |
1.531 |
| Flash point |
116.6°C |
| Vapour Pressur |
0.00103mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
