ChemNet > CAS > 576-82-9 5-Fluoro-1,2,3-tribromobenzene
576-82-9 5-Fluoro-1,2,3-tribromobenzene
| product Name |
5-Fluoro-1,2,3-tribromobenzene |
| CAS No |
576-82-9 |
| Synonyms |
1,2,3-Tribromo-5-fluorobenzene |
| Molecular Formula |
C6H2Br3F |
| Molecular Weight |
332.7905 |
| InChI |
InChI=1/C6H2Br3F/c7-4-1-3(10)2-5(8)6(4)9/h1-2H |
| Molecular Structure |
|
| Density |
2.34g/cm3 |
| Boiling point |
274.2°C at 760 mmHg |
| Refractive index |
1.61 |
| Flash point |
119.6°C |
| Vapour Pressur |
0.0092mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
