ChemNet > CAS > 57690-62-7 Methyl 3,4-di-O-acetyl-D-glucuronal
57690-62-7 Methyl 3,4-di-O-acetyl-D-glucuronal
| product Name |
Methyl 3,4-di-O-acetyl-D-glucuronal |
| CAS No |
57690-62-7 |
| Synonyms |
methyl 3,4-di-O-acetyl-2,6-anhydro-5-deoxy-D-lyxo-hex-5-enonate |
| Molecular Formula |
C11H14O7 |
| Molecular Weight |
258.2247 |
| InChI |
InChI=1/C11H14O7/c1-6(12)17-8-4-5-16-10(11(14)15-3)9(8)18-7(2)13/h4-5,8-10H,1-3H3/t8-,9+,10+/m1/s1 |
| Molecular Structure |
|
| Density |
1.27g/cm3 |
| Boiling point |
329°C at 760 mmHg |
| Refractive index |
1.484 |
| Flash point |
143.2°C |
| Vapour Pressur |
0.000183mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
