ChemNet > CAS > 577-71-9 3,4-dinitrophenol moistened with water (H2O ~20%)
577-71-9 3,4-dinitrophenol moistened with water (H2O ~20%)
| product Name |
3,4-dinitrophenol moistened with water (H2O ~20%) |
| CAS No |
577-71-9 |
| Synonyms |
3,4-Dinitrophenol |
| Molecular Formula |
C6H4N2O5 |
| Molecular Weight |
184.1064 |
| InChI |
InChI=1/C6H4N2O5/c9-4-1-2-5(7(10)11)6(3-4)8(12)13/h1-3,9H |
| EINECS |
209-415-3 |
| Molecular Structure |
|
| Density |
1.65g/cm3 |
| Boiling point |
418.7°C at 760 mmHg |
| Refractive index |
1.66 |
| Flash point |
194.1°C |
| Vapour Pressur |
1.33E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
