ChemNet > CAS > 5773-80-8 6-bromo-2-naphthoic acid
5773-80-8 6-bromo-2-naphthoic acid
| product Name |
6-bromo-2-naphthoic acid |
| CAS No |
5773-80-8 |
| Synonyms |
2-naphthalenecarboxylic acid, 6-bromo-; 6-Bromo-2-naphthoicacid; 6-bromonaphthalene-2-carboxylic acid; 6-Bromo-2-naphthoicacid,96%; 6-BROMO-2-NAPHTHOIC ACID 99%; 6-bromo-2-Naphthalenecarboxylic acid |
| Molecular Formula |
C11H7BrO2 |
| Molecular Weight |
251.0761 |
| InChI |
InChI=1/C11H7BrO2/c12-10-4-3-7-5-9(11(13)14)2-1-8(7)6-10/h1-6H,(H,13,14) |
| Molecular Structure |
|
| Density |
1.648g/cm3 |
| Melting point |
294-295℃ |
| Boiling point |
387.3°C at 760 mmHg |
| Refractive index |
1.697 |
| Flash point |
188°C |
| Vapour Pressur |
1.08E-06mmHg at 25°C |
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
Featured China Suppliers
| Telephone |
+86-21-33927743;33927342 |
| Email |
info@hebeismart.com |
| Address |
Room 2702,Information Tower,1403 Minsheng Road,Shanghai,200135,China. |
| Contact |
Gu Xiaoxing |
| Telephone |
+86-519-86461196;86464994 |
| Email |
gxx@xingshengtech.com;gxy@xingshengtech.com |
| Address |
Miaoqiao St.,Wujin District,Changzhou City, Jiangsu, China. |
| Telephone |
+86-21-68769091 |
| Email |
info@tritonchemtech.com |
| Address |
Room 717, 7/F, Information Tower, 1403 Minsheng Road, Shanghai, 200135, China |
| Contact |
Mr.Chen |
| Telephone |
+86-571-87040515 |
| Email |
chenhk@hzph.com |
| Address |
QinglianBldg.No,139QingchunRd,HangzhouCity,Zhejiang,China |
| Contact |
Ronnie Du |
| Telephone |
0792-6529768 13576228007 |
| Email |
sales@ztpharm.com |
| Address |
Jinshawan Industry City Hukou Jiujiang City Jiangxi China |