ChemNet > CAS > 57744-67-9 6-iodo-2,3-dihydro-1,4-benzodioxine
57744-67-9 6-iodo-2,3-dihydro-1,4-benzodioxine
| product Name |
6-iodo-2,3-dihydro-1,4-benzodioxine |
| CAS No |
57744-67-9 |
| Synonyms |
3,4-Ethylenedioxyiodobenzene |
| Molecular Formula |
C8H7IO2 |
| Molecular Weight |
262.0444 |
| InChI |
InChI=1/C8H7IO2/c9-6-1-2-7-8(5-6)11-4-3-10-7/h1-2,5H,3-4H2 |
| Molecular Structure |
|
| Density |
1.866g/cm3 |
| Boiling point |
281.7°C at 760 mmHg |
| Refractive index |
1.629 |
| Flash point |
124.2°C |
| Vapour Pressur |
0.00598mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
