ChemNet > CAS > 5781-53-3 Methyl oxalyl chloride
5781-53-3 Methyl oxalyl chloride
| product Name |
Methyl oxalyl chloride |
| CAS No |
5781-53-3 |
| Synonyms |
Methyl chloroglyoxylate; Monomethyl oxalyl chloride; methyl chlorooxoacetate; Chloroglyoxylic acid methyl ester |
| Molecular Formula |
C3H3ClO3 |
| Molecular Weight |
122.5071 |
| InChI |
InChI=1/C3H3ClO3/c1-7-3(6)2(4)5/h1H3 |
| EINECS |
227-307-4 |
| Molecular Structure |
|
| Density |
1.36g/cm3 |
| Boiling point |
119°C at 760 mmHg |
| Refractive index |
1.416 |
| Flash point |
46.7°C |
| Vapour Pressur |
16.3mmHg at 25°C |
| Hazard Symbols |
 C:Corrosive;
|
| Risk Codes |
R10:Flammable.;
R34:Causes burns.;
|
| Safety Description |
S16:Keep away from sources of ignition - No smoking.;
S28A:After contact with skin, wash immediately with plenty of water.;
S9:Keep container in a well-ventilated place.;
|
| MSDS |
Material Safety Data Sheet
|
|
