ChemNet > CAS > 5785-06-8 3-Methoxybenzhydrazide
5785-06-8 3-Methoxybenzhydrazide
| product Name |
3-Methoxybenzhydrazide |
| CAS No |
5785-06-8 |
| Synonyms |
m-Anisic hydrazide; 3-Methoxybenzoic hydrazide; 3-methoxybenzohydrazide |
| Molecular Formula |
C8H10N2O2 |
| Molecular Weight |
166.1772 |
| InChI |
InChI=1/C8H10N2O2/c1-12-7-4-2-3-6(5-7)8(11)10-9/h2-5H,9H2,1H3,(H,10,11) |
| EINECS |
227-310-0 |
| Molecular Structure |
|
| Density |
1.178g/cm3 |
| Melting point |
91℃ |
| Refractive index |
1.558 |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
