ChemNet > CAS > 5785-66-0 Cyclopropyl diphenyl carbinol
5785-66-0 Cyclopropyl diphenyl carbinol
| product Name |
Cyclopropyl diphenyl carbinol |
| CAS No |
5785-66-0 |
| Synonyms |
alpha-Cyclopropylbenzhydrol~Cyclopropyl diphenyl carbinol; Cyclopropyldiphenylmethanol; alpha-cyclopropylbenzhydryl alcohol; N-[(1E)-(4-methoxyphenyl)methylidene]-3,5-dimethyl-4H-1,2,4-triazol-4-amine |
| Molecular Formula |
C12H14N4O |
| Molecular Weight |
230.2658 |
| InChI |
InChI=1/C12H14N4O/c1-9-14-15-10(2)16(9)13-8-11-4-6-12(17-3)7-5-11/h4-8H,1-3H3/b13-8+ |
| EINECS |
227-312-1 |
| Molecular Structure |
|
| Density |
1.16g/cm3 |
| Melting point |
82-85℃ |
| Boiling point |
419°C at 760 mmHg |
| Refractive index |
1.59 |
| Flash point |
207.2°C |
| Vapour Pressur |
3.13E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
