ChemNet > CAS > 579-49-7 (4-Fluorophenyl)-(2-thienyl) ketone
579-49-7 (4-Fluorophenyl)-(2-thienyl) ketone
| product Name |
(4-Fluorophenyl)-(2-thienyl) ketone |
| CAS No |
579-49-7 |
| Synonyms |
(4-Fluorophenyl)-2-thienyl methanone; 4-Fluorophenyl-2-thienyl ketone; (4-fluorophenyl)(thiophen-2-yl)methanone |
| Molecular Formula |
C11H7FOS |
| Molecular Weight |
206.2361 |
| InChI |
InChI=1/C11H7FOS/c12-9-5-3-8(4-6-9)11(13)10-2-1-7-14-10/h1-7H |
| EINECS |
209-442-0 |
| Molecular Structure |
|
| Density |
1.279g/cm3 |
| Melting point |
94-99℃ |
| Boiling point |
314.7°C at 760 mmHg |
| Refractive index |
1.59 |
| Flash point |
144.1°C |
| Vapour Pressur |
0.000459mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
