ChemNet > CAS > 57981-02-9 O-(2,3,4,5,6-Pentafluorobenzyl)hydroxylamine hydrochloride
57981-02-9 O-(2,3,4,5,6-Pentafluorobenzyl)hydroxylamine hydrochloride
| product Name |
O-(2,3,4,5,6-Pentafluorobenzyl)hydroxylamine hydrochloride |
| CAS No |
57981-02-9 |
| Synonyms |
O-(2,3,4,5,6-pentafluorobenzyl)*hydroxylamine hyd; O-(pentafluorobenzyl)hydroxylamine; [(pentafluorobenzyl)oxy]ammonium chloride |
| Molecular Formula |
C7H5ClF5NO |
| Molecular Weight |
249.5657 |
| InChI |
InChI=1/C7H5F5NO.ClH/c8-3-2(1-14-13)4(9)6(11)7(12)5(3)10;/h1H2,13H3;1H/q+1;/p-1 |
| EINECS |
261-057-7 |
| Molecular Structure |
|
| Melting point |
227℃ |
| Boiling point |
214.5°C at 760 mmHg |
| Flash point |
83.5°C |
| Vapour Pressur |
0.155mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
| MSDS |
Material Safety Data Sheet
|
|
