ChemNet > CAS > 581-55-5 Benzal diacetate
581-55-5 Benzal diacetate
| product Name |
Benzal diacetate |
| CAS No |
581-55-5 |
| Synonyms |
Benzal diacetate, (a,a-Diacetoxytoluene); alpha,alpha-Diacetoxytoluene; (acetoxy-phenyl-methyl) acetate |
| Molecular Formula |
C11H12O4 |
| Molecular Weight |
208.2106 |
| InChI |
InChI=1/C11H12O4/c1-8(12)14-11(15-9(2)13)10-6-4-3-5-7-10/h3-7,11H,1-2H3 |
| EINECS |
209-469-8 |
| Molecular Structure |
|
| Density |
1.16g/cm3 |
| Melting point |
44-46℃ |
| Boiling point |
220°C at 760 mmHg |
| Refractive index |
1.505 |
| Flash point |
85.5°C |
| Vapour Pressur |
0.116mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
