ChemNet > CAS > 58157-89-4 1-(5-nitro-3-thienyl)ethan-1-one
58157-89-4 1-(5-nitro-3-thienyl)ethan-1-one
| product Name |
1-(5-nitro-3-thienyl)ethan-1-one |
| CAS No |
58157-89-4 |
| Synonyms |
4-Acetyl-2-nitrothiophene; 1-(5-nitrothiophen-3-yl)ethanone |
| Molecular Formula |
C6H5NO3S |
| Molecular Weight |
171.1738 |
| InChI |
InChI=1/C6H5NO3S/c1-4(8)5-2-6(7(9)10)11-3-5/h2-3H,1H3 |
| Molecular Structure |
|
| Density |
1.399g/cm3 |
| Melting point |
59℃ |
| Boiling point |
247.9°C at 760 mmHg |
| Refractive index |
1.589 |
| Flash point |
103.7°C |
| Vapour Pressur |
0.025mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
