ChemNet > CAS > 5819-40-9 4-bromo-5-methylisoxazol-3-amine
5819-40-9 4-bromo-5-methylisoxazol-3-amine
| product Name |
4-bromo-5-methylisoxazol-3-amine |
| CAS No |
5819-40-9 |
| Synonyms |
3-Amino-4-bromo-5-methylisoxazole; 4-bromo-3-methyl-1,2-oxazol-5-amine |
| Molecular Formula |
C4H5BrN2O |
| Molecular Weight |
176.9993 |
| InChI |
InChI=1/C4H5BrN2O/c1-2-3(5)4(6)8-7-2/h6H2,1H3 |
| Molecular Structure |
|
| Density |
1.767g/cm3 |
| Melting point |
73℃ |
| Boiling point |
273.538°C at 760 mmHg |
| Refractive index |
1.581 |
| Flash point |
119.232°C |
| Vapour Pressur |
0.006mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
