ChemNet > CAS > 583-05-1 1-Phenyl-1,4-pentanedione
583-05-1 1-Phenyl-1,4-pentanedione
| product Name |
1-Phenyl-1,4-pentanedione |
| CAS No |
583-05-1 |
| Synonyms |
1-phenylpentane-1,4-dione |
| Molecular Formula |
C11H12O2 |
| Molecular Weight |
176.2118 |
| InChI |
InChI=1/C11H12O2/c1-9(12)7-8-11(13)10-5-3-2-4-6-10/h2-6H,7-8H2,1H3 |
| Molecular Structure |
|
| Density |
1.051g/cm3 |
| Boiling point |
305.8°C at 760 mmHg |
| Refractive index |
1.51 |
| Flash point |
114.3°C |
| Vapour Pressur |
0.000804mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
