ChemNet > CAS > 584-03-2 1,2-Butanediol
584-03-2 1,2-Butanediol
| product Name |
1,2-Butanediol |
| CAS No |
584-03-2;26171-83-5 |
| Synonyms |
.+/-.-1,2-Butanediol; 1,2-Butanediol, (.+/-.)-; Butane-1,2-diol; Butanediol, 1,2-; 1,2-Dihydroxybutane; 4-01-00-02507 (Beilstein Handbook Reference); AI3-07554; BRN 0969169; HSDB 1507; NSC 24242; alpha-Butylene glycol; alpha-Butyleneglycol; (2S)-butane-1,2-diol |
| Molecular Formula |
C4H10O2 |
| Molecular Weight |
90.121 |
| InChI |
InChI=1/C4H10O2/c1-2-4(6)3-5/h4-6H,2-3H2,1H3 |
| EINECS |
209-527-2 |
| Molecular Structure |
|
| Density |
1.001g/cm3 |
| Melting point |
-50℃ |
| Boiling point |
190.3°C at 760 mmHg |
| Refractive index |
1.437 |
| Flash point |
93.3°C |
| Vapour Pressur |
0.148mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
