ChemNet > CAS > 58452-00-9 3-Benzyloxy-4-methoxybenzoic acid
58452-00-9 3-Benzyloxy-4-methoxybenzoic acid
| product Name |
3-Benzyloxy-4-methoxybenzoic acid |
| CAS No |
58452-00-9 |
| Synonyms |
3-Benzyloxy-p-anisic acid |
| Molecular Formula |
C15H14O4 |
| Molecular Weight |
258.2693 |
| InChI |
InChI=1/C15H14O4/c1-18-13-8-7-12(15(16)17)9-14(13)19-10-11-5-3-2-4-6-11/h2-9H,10H2,1H3,(H,16,17) |
| EINECS |
261-260-0 |
| Molecular Structure |
|
| Density |
1.225g/cm3 |
| Boiling point |
416.6°C at 760 mmHg |
| Refractive index |
1.589 |
| Flash point |
156°C |
| Vapour Pressur |
1.1E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
