ChemNet > CAS > 58477-85-3 N,N'-Diallyl-L-tartardiamide
58477-85-3 N,N'-Diallyl-L-tartardiamide
| product Name |
N,N'-Diallyl-L-tartardiamide |
| CAS No |
58477-85-3 |
| Synonyms |
DATD; (2R,3R)-2,3-dihydroxy-N,N'-di(prop-2-en-1-yl)butanediamide; 2,3-dihydroxy-N,N'-di(prop-2-en-1-yl)butanediamide; (2S,3S)-2,3-dihydroxy-N,N'-diprop-2-en-1-ylbutanediamide |
| Molecular Formula |
C10H16N2O4 |
| Molecular Weight |
228.245 |
| InChI |
InChI=1/C10H16N2O4/c1-3-5-11-9(15)7(13)8(14)10(16)12-6-4-2/h3-4,7-8,13-14H,1-2,5-6H2,(H,11,15)(H,12,16)/t7-,8-/m0/s1 |
| EINECS |
261-277-3 |
| Molecular Structure |
|
| Density |
1.192g/cm3 |
| Melting point |
184-185℃ |
| Boiling point |
566.8°C at 760 mmHg |
| Refractive index |
1.518 |
| Flash point |
296.6°C |
| Vapour Pressur |
3.31E-15mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
