588-68-1 benzaldehyde azine
product Name |
benzaldehyde azine |
CAS No |
588-68-1 |
Synonyms |
Benzalazine; Benzylideneazine; dibenzylidenehydrazine; Benzylidene azine |
Molecular Formula |
C14H12N2 |
Molecular Weight |
208.2585 |
InChI |
InChI=1/C14H12N2/c1-3-7-13(8-4-1)11-15-16-12-14-9-5-2-6-10-14/h1-12H |
EINECS |
209-627-6 |
Molecular Structure |
|
Density |
0.98g/cm3 |
Boiling point |
318.3°C at 760 mmHg |
Refractive index |
1.56 |
Flash point |
138.3°C |
Vapour Pressur |
0.000681mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|