ChemNet > CAS > 589-17-3 4-Bromobenzyl chloride
589-17-3 4-Bromobenzyl chloride
| product Name |
4-Bromobenzyl chloride |
| CAS No |
589-17-3 |
| Synonyms |
4-Bromo-alpha-chlorotoluene; 1-Bromo-4-(chloromethyl)-benzene; p-Bromobenzyl chloride |
| Molecular Formula |
C7H6BrCl |
| Molecular Weight |
205.4795 |
| InChI |
InChI=1/C7H6BrCl/c8-7-3-1-6(5-9)2-4-7/h1-4H,5H2 |
| EINECS |
209-638-6 |
| Molecular Structure |
|
| Density |
1.541g/cm3 |
| Melting point |
36-40℃ |
| Boiling point |
236°C at 760 mmHg |
| Refractive index |
1.569 |
| Flash point |
111.7°C |
| Vapour Pressur |
0.0744mmHg at 25°C |
| Hazard Symbols |
 C:Corrosive;
|
| Risk Codes |
R34:Causes burns.;
R36/37:Irritating to eyes and respiratory system.;
|
| Safety Description |
S25:Avoid contact with eyes.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
| MSDS |
Material Safety Data Sheet
|
|
