ChemNet > CAS > 589-82-2 3-Heptanol
589-82-2 3-Heptanol
| product Name |
3-Heptanol |
| CAS No |
589-82-2 |
| Synonyms |
heptan-3-ol; (3R)-heptan-3-ol; (3S)-heptan-3-ol |
| Molecular Formula |
C7H16O |
| Molecular Weight |
116.2013 |
| InChI |
InChI=1/C7H16O/c1-3-5-6-7(8)4-2/h7-8H,3-6H2,1-2H3/t7-/m0/s1 |
| EINECS |
209-661-1 |
| Molecular Structure |
|
| Density |
0.818g/cm3 |
| Melting point |
-70℃ |
| Boiling point |
156.7°C at 760 mmHg |
| Refractive index |
1.42 |
| Flash point |
54.4°C |
| Vapour Pressur |
1.03mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R22:Harmful if swallowed.;
R36:Irritating to eyes.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
