ChemNet > CAS > 589-91-3 4-Methylcyclohexanol, mixture of cis and trans
589-91-3 4-Methylcyclohexanol, mixture of cis and trans
| product Name |
4-Methylcyclohexanol, mixture of cis and trans |
| CAS No |
589-91-3 |
| Synonyms |
4-Methylcyclohexanol (cis+trans); 4-Methylcyclohexanol; trans-4-methylcyclohexanol; Methyl cyclohexanol |
| Molecular Formula |
C7H14O |
| Molecular Weight |
114.1855 |
| InChI |
InChI=1/C7H14O/c1-6-2-4-7(8)5-3-6/h6-8H,2-5H2,1H3/t6-,7- |
| EINECS |
209-664-8 |
| Molecular Structure |
|
| Density |
0.925g/cm3 |
| Melting point |
-41℃ |
| Boiling point |
170.322°C at 760 mmHg |
| Refractive index |
1.463 |
| Flash point |
70°C |
| Water solubility |
slightly soluble |
| Vapour Pressur |
0.475mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:;
|
| MSDS |
Material Safety Data Sheet
|
|
