ChemNet > CAS > 589-98-0 3-Octanol
589-98-0 3-Octanol
| product Name |
3-Octanol |
| CAS No |
589-98-0;20296-29-1 |
| Synonyms |
DL-3-Octanol; ethylpentylcarbinol; n-Amyl ethyl carbinol; Ethyl n-pentyl carbinol; (3S)-octan-3-ol; (±)-octan-3-ol; (3R)-octan-3-ol |
| Molecular Formula |
C8H18O |
| Molecular Weight |
130.2279 |
| InChI |
InChI=1/C8H18O/c1-3-5-6-7-8(9)4-2/h8-9H,3-7H2,1-2H3/t8-/m0/s1 |
| EINECS |
209-667-4 |
| Molecular Structure |
|
| Density |
0.821g/cm3 |
| Melting point |
-45℃ |
| Boiling point |
169°C at 760 mmHg |
| Refractive index |
1.426 |
| Flash point |
65.6°C |
| Vapour Pressur |
0.512mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
