ChemNet > CAS > 58971-11-2 3-Bromophenethylamine
58971-11-2 3-Bromophenethylamine
| product Name |
3-Bromophenethylamine |
| CAS No |
58971-11-2 |
| Synonyms |
2-(3-bromophenyl)ethanaminium; 2-(3-bromophenyl)ethanamine; 3-Bromo-benzeneethanamine |
| Molecular Formula |
C8H10BrN |
| Molecular Weight |
200.0757 |
| InChI |
InChI=1/C8H10BrN/c9-8-3-1-2-7(6-8)4-5-10/h1-3,6H,4-5,10H2 |
| Molecular Structure |
|
| Density |
1.407g/cm3 |
| Boiling point |
263.4°C at 760 mmHg |
| Refractive index |
1.575 |
| Flash point |
113.1°C |
| Vapour Pressur |
0.0103mmHg at 25°C |
| Hazard Symbols |
 C:Corrosive;
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
| MSDS |
Material Safety Data Sheet
|
|
