ChemNet > CAS > 58984-19-3 Hexanedioic acid, ester with 2,2'-oxybis[ethanol]
58984-19-3 Hexanedioic acid, ester with 2,2'-oxybis[ethanol]
| product Name |
Hexanedioic acid, ester with 2,2'-oxybis[ethanol] |
| CAS No |
58984-19-3 |
| Synonyms |
Hexanedioic acid, ester with 2,2'-oxybis(ethanol); Diethylene glycol adipate; 6-[2-(2-hydroxyethoxy)ethoxy]-6-oxohexanoic acid |
| Molecular Formula |
C10H18O6 |
| Molecular Weight |
234.2463 |
| InChI |
InChI=1/C10H18O6/c11-5-6-15-7-8-16-10(14)4-2-1-3-9(12)13/h11H,1-8H2,(H,12,13) |
| EINECS |
261-541-8 |
| Molecular Structure |
![58984-19-3 Hexanedioic acid, ester with 2,2'-oxybis[ethanol]](https://images-a.chemnet.com/suppliers/chembase/cas4/cas58984-19-3.gif)
|
| Density |
1.197g/cm3 |
| Boiling point |
412.9°C at 760 mmHg |
| Refractive index |
1.474 |
| Flash point |
158.5°C |
| Vapour Pressur |
1.53E-08mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
