ChemNet > CAS > 59-82-5 5-Nitro-2-furonitrile
59-82-5 5-Nitro-2-furonitrile
| product Name |
5-Nitro-2-furonitrile |
| CAS No |
59-82-5 |
| Synonyms |
5-Nitro-2-furancarbonitrile; 5-nitrofuran-2-carbonitrile |
| Molecular Formula |
C5H2N2O3 |
| Molecular Weight |
138.081 |
| InChI |
InChI=1/C5H2N2O3/c6-3-4-1-2-5(10-4)7(8)9/h1-2H |
| Molecular Structure |
|
| Density |
1.46g/cm3 |
| Boiling point |
234.7°C at 760 mmHg |
| Refractive index |
1.544 |
| Flash point |
95.7°C |
| Vapour Pressur |
0.0522mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
