ChemNet > CAS > 59084-16-1 1-Acetylpiperidine-4-carbonyl chloride
59084-16-1 1-Acetylpiperidine-4-carbonyl chloride
| product Name |
1-Acetylpiperidine-4-carbonyl chloride |
| CAS No |
59084-16-1 |
| Synonyms |
N-Acetylisonipecotoyl chloride; 1-Acetylisonipecotoyl Chloride |
| Molecular Formula |
C8H12ClNO2 |
| Molecular Weight |
189.6394 |
| InChI |
InChI=1/C8H12ClNO2/c1-6(11)10-4-2-7(3-5-10)8(9)12/h7H,2-5H2,1H3 |
| EINECS |
261-594-7 |
| Molecular Structure |
|
| Density |
1.224g/cm3 |
| Boiling point |
308°C at 760 mmHg |
| Refractive index |
1.496 |
| Flash point |
140.1°C |
| Vapour Pressur |
0.0007mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
