ChemNet > CAS > 591-23-1 3-Methylcyclohexanol, mixture of cis and trans
591-23-1 3-Methylcyclohexanol, mixture of cis and trans
| product Name |
3-Methylcyclohexanol, mixture of cis and trans |
| CAS No |
591-23-1 |
| Synonyms |
3-Methylcyclohexanol (cis+trans); 3-Methylcyclohexanol; (1S,3R)-3-methylcyclohexanol; (1R,3R)-3-methylcyclohexanol; (1S,3S)-3-methylcyclohexanol |
| Molecular Formula |
C7H14O |
| Molecular Weight |
114.1855 |
| InChI |
InChI=1/C7H14O/c1-6-3-2-4-7(8)5-6/h6-8H,2-5H2,1H3/t6-,7-/m0/s1 |
| EINECS |
209-709-1 |
| Molecular Structure |
|
| Density |
0.925g/cm3 |
| Melting point |
-74℃ |
| Boiling point |
170.3°C at 760 mmHg |
| Refractive index |
1.462 |
| Flash point |
62.8°C |
| Vapour Pressur |
0.475mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
