ChemNet > CAS > 593-08-8 2-Tridecanone
593-08-8 2-Tridecanone
| product Name |
2-Tridecanone |
| CAS No |
593-08-8 |
| Synonyms |
Methyl undecyl ketone |
| Molecular Formula |
C13H26O |
| Molecular Weight |
198.35 |
| InChI |
InChI=1/C13H26O/c1-3-4-5-6-7-8-9-10-11-12-13(2)14/h3-12H2,1-2H3 |
| EINECS |
209-784-0 |
| Molecular Structure |
|
| Density |
0.822 |
| Melting point |
24-27℃ |
| Boiling point |
263℃ |
| Refractive index |
1.435 |
| Flash point |
>110℃ |
| Hazard Symbols |
 N:;
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
