ChemNet > CAS > 593-96-4 1-Bromo-1-chloroethane
593-96-4 1-Bromo-1-chloroethane
| product Name |
1-Bromo-1-chloroethane |
| CAS No |
593-96-4 |
| Synonyms |
Ethane, 1-bromo-1-chloro- |
| Molecular Formula |
C2H4BrCl |
| Molecular Weight |
143.4102 |
| InChI |
InChI=1/C2H4BrCl/c1-2(3)4/h2H,1H3 |
| EINECS |
209-820-5 |
| Molecular Structure |
|
| Density |
1.658g/cm3 |
| Boiling point |
79.5°C at 760 mmHg |
| Refractive index |
1.463 |
| Vapour Pressur |
98.1mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
