ChemNet > CAS > 59463-56-8 cyanomethyl ethanethioate
59463-56-8 cyanomethyl ethanethioate
| product Name |
cyanomethyl ethanethioate |
| CAS No |
59463-56-8 |
| Synonyms |
S-(cyanomethyl) ethanethioate |
| Molecular Formula |
C4H5NOS |
| Molecular Weight |
115.1536 |
| InChI |
InChI=1/C4H5NOS/c1-4(6)7-3-2-5/h3H2,1H3 |
| Molecular Structure |
|
| Density |
1.162g/cm3 |
| Boiling point |
198.1°C at 760 mmHg |
| Refractive index |
1.487 |
| Flash point |
73.6°C |
| Vapour Pressur |
0.367mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
|
| MSDS |
Material Safety Data Sheet
|
|
