ChemNet > CAS > 5949-05-3 L(-)-Citronellal
5949-05-3 L(-)-Citronellal
| product Name |
L(-)-Citronellal |
| CAS No |
5949-05-3 |
| Synonyms |
(S)-(-)-3,7-Dimethyl-6-octenal; (S)-()-Citronellal; Citrnellal; (-)-Citrnellal; (3S)-3,7-dimethyloct-6-enal; (-)-Citronellal |
| Molecular Formula |
C10H18O |
| Molecular Weight |
154.2493 |
| InChI |
InChI=1/C10H18O/c1-9(2)5-4-6-10(3)7-8-11/h5,8,10H,4,6-7H2,1-3H3/t10-/m0/s1 |
| EINECS |
227-707-9 |
| Molecular Structure |
|
| Density |
0.835g/cm3 |
| Boiling point |
208.4°C at 760 mmHg |
| Refractive index |
1.437 |
| Flash point |
75.6°C |
| Vapour Pressur |
0.215mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
