ChemNet > CAS > 59548-39-9 4-Methoxy-o-phenylenediamine dihydrochloride
59548-39-9 4-Methoxy-o-phenylenediamine dihydrochloride
| product Name |
4-Methoxy-o-phenylenediamine dihydrochloride |
| CAS No |
59548-39-9 |
| Synonyms |
3,4-Diaminoanisole dihydrochloride; 4-methoxybenzene-1,2-diamine dihydrochloride |
| Molecular Formula |
C7H12Cl2N2O |
| Molecular Weight |
211.089 |
| InChI |
InChI=1/C7H10N2O.2ClH/c1-10-5-2-3-6(8)7(9)4-5;;/h2-4H,8-9H2,1H3;2*1H |
| EINECS |
261-801-0 |
| Molecular Structure |
|
| Melting point |
210-209℃ |
| Boiling point |
302.4°C at 760 mmHg |
| Flash point |
161.7°C |
| Vapour Pressur |
0.000994mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
