ChemNet > CAS > 596-38-3 9-Phenylxanthen-9-ol
596-38-3 9-Phenylxanthen-9-ol
| product Name |
9-Phenylxanthen-9-ol |
| CAS No |
596-38-3 |
| Synonyms |
Phenylxanthenol; 9-phenyl-9H-xanthen-9-ol |
| Molecular Formula |
C19H14O2 |
| Molecular Weight |
274.3133 |
| InChI |
InChI=1/C19H14O2/c20-19(14-8-2-1-3-9-14)15-10-4-6-12-17(15)21-18-13-7-5-11-16(18)19/h1-13,20H |
| EINECS |
209-882-3 |
| Molecular Structure |
|
| Density |
1.265g/cm3 |
| Melting point |
158-162℃ |
| Boiling point |
432.6°C at 760 mmHg |
| Refractive index |
1.674 |
| Flash point |
199.7°C |
| Vapour Pressur |
2.98E-08mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
