ChemNet > CAS > 59662-32-7 4-n-Heptylbiphenyl
59662-32-7 4-n-Heptylbiphenyl
| product Name |
4-n-Heptylbiphenyl |
| CAS No |
59662-32-7 |
| Synonyms |
4-N-Heptyldiphenyl; 4-heptylbiphenyl |
| Molecular Formula |
C19H24 |
| Molecular Weight |
252.3939 |
| InChI |
InChI=1/C19H24/c1-2-3-4-5-7-10-17-13-15-19(16-14-17)18-11-8-6-9-12-18/h6,8-9,11-16H,2-5,7,10H2,1H3 |
| Molecular Structure |
|
| Density |
0.934g/cm3 |
| Boiling point |
366.7°C at 760 mmHg |
| Refractive index |
1.531 |
| Flash point |
189.7°C |
| Vapour Pressur |
3.02E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
