ChemNet > CAS > 598-38-9 2,2-dichloroethanol
598-38-9 2,2-dichloroethanol
| product Name |
2,2-dichloroethanol |
| CAS No |
598-38-9 |
| Synonyms |
2,2-Dichloroethanol; 4-01-00-01383 (Beilstein Handbook Reference); BRN 1731633; Dichloroethanol; NSC 60513; Ethanol, 2,2-dichloro- |
| Molecular Formula |
C2H4Cl2O |
| Molecular Weight |
114.9586 |
| InChI |
InChI=1/C2H4Cl2O/c3-2(4)1-5/h2,5H,1H2 |
| EINECS |
209-931-9 |
| Molecular Structure |
|
| Density |
1.398g/cm3 |
| Boiling point |
146°C at 760 mmHg |
| Refractive index |
1.459 |
| Flash point |
78.3°C |
| Vapour Pressur |
1.86mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R40:Possible risks of irreversible effects.;
|
| Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
