ChemNet > CAS > 598-52-7 N-Methylthiourea
598-52-7 N-Methylthiourea
| product Name |
N-Methylthiourea |
| CAS No |
598-52-7 |
| Synonyms |
N-Methyl thiourea; 1-methylthiourea |
| Molecular Formula |
C2H6N2S |
| Molecular Weight |
90.1474 |
| InChI |
InChI=1/C2H6N2S/c1-4-2(3)5/h1H3,(H3,3,4,5) |
| EINECS |
209-936-6 |
| Molecular Structure |
|
| Density |
1.14g/cm3 |
| Melting point |
118-123℃ |
| Boiling point |
141.1°C at 760 mmHg |
| Refractive index |
1.564 |
| Flash point |
39.1°C |
| Vapour Pressur |
5.95mmHg at 25°C |
| Hazard Symbols |
 T:Toxic;
|
| Risk Codes |
R25:Toxic if swallowed.;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
