ChemNet > CAS > 598-88-9 1,2-dichloro-1,2-difluoroethylene
598-88-9 1,2-dichloro-1,2-difluoroethylene
| product Name |
1,2-dichloro-1,2-difluoroethylene |
| CAS No |
598-88-9 |
| Synonyms |
1,2-Dichloro-1,2-difluoroethylene; Ethene, 1,2-dichloro-1,2-difluoro-; 1,2-dichloro-1,2-difluoroethene; (Z)-1,2-dichloro-1,2-difluoroethene; (E)-1,2-dichloro-1,2-difluoroethene |
| Molecular Formula |
C2Cl2F2 |
| Molecular Weight |
132.9242 |
| InChI |
InChI=1/C2Cl2F2/c3-1(5)2(4)6/b2-1+ |
| EINECS |
209-956-5 |
| Molecular Structure |
|
| Density |
1.503g/cm3 |
| Boiling point |
22.8°C at 760 mmHg |
| Refractive index |
1.392 |
| Vapour Pressur |
821mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S9:Keep container in a well-ventilated place.;
|
|
