5980-23-4 3,5-Dichlorobenzamide
product Name |
3,5-Dichlorobenzamide |
CAS No |
5980-23-4 |
Molecular Formula |
C7H5Cl2NO |
Molecular Weight |
190.0267 |
InChI |
InChI=1/C7H5Cl2NO/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3H,(H2,10,11) |
Molecular Structure |
|
Density |
1.439g/cm3 |
Boiling point |
264.2°C at 760 mmHg |
Refractive index |
1.596 |
Flash point |
113.6°C |
Vapour Pressur |
0.00984mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|