ChemNet > CAS > 59944-65-9 4-methyl-1,2,3-thiadiazole-5-carbonyl chloride
59944-65-9 4-methyl-1,2,3-thiadiazole-5-carbonyl chloride
| product Name |
4-methyl-1,2,3-thiadiazole-5-carbonyl chloride |
| CAS No |
59944-65-9 |
| Molecular Formula |
C4H3ClN2OS |
| Molecular Weight |
162.5974 |
| InChI |
InChI=1/C4H3ClN2OS/c1-2-3(4(5)8)9-7-6-2/h1H3 |
| Molecular Structure |
|
| Density |
1.504g/cm3 |
| Boiling point |
239.9°C at 760 mmHg |
| Refractive index |
1.578 |
| Flash point |
98.9°C |
| Vapour Pressur |
0.0391mmHg at 25°C |
| Hazard Symbols |
 C:Corrosive;
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
| MSDS |
Material Safety Data Sheet
|
|
