ChemNet > CAS > 60088-54-2 Terephthalic-d4 acid
60088-54-2 Terephthalic-d4 acid
| product Name |
Terephthalic-d4 acid |
| CAS No |
60088-54-2 |
| Synonyms |
(2,3,5,6-2H4)Terephthalic acid; benzene-1,4-dicarboxylic acid; (~2~H_4_)benzene-1,4-dicarboxylic acid |
| Molecular Formula |
C8H2D4O4 |
| Molecular Weight |
170.1555 |
| InChI |
InChI=1/C8H6O4/c9-7(10)5-1-2-6(4-3-5)8(11)12/h1-4H,(H,9,10)(H,11,12)/i1D,2D,3D,4D |
| EINECS |
262-050-1 |
| Molecular Structure |
|
| Density |
1.486g/cm3 |
| Melting point |
300℃ |
| Boiling point |
392.4°C at 760 mmHg |
| Refractive index |
1.617 |
| Flash point |
205.3°C |
| Vapour Pressur |
7.35E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
