ChemNet > CAS > 602-55-1 9-Phenylanthracene
602-55-1 9-Phenylanthracene
| product Name |
9-Phenylanthracene |
| CAS No |
602-55-1 |
| Synonyms |
Phenylanthracene; anthracene,9-phenyl-; 9-phenylantracene |
| Molecular Formula |
C20H14 |
| Molecular Weight |
254.3252 |
| InChI |
InChI=1/C20H14/c1-2-8-15(9-3-1)20-18-12-6-4-10-16(18)14-17-11-5-7-13-19(17)20/h1-14H |
| EINECS |
210-019-8 |
| Molecular Structure |
|
| Density |
1.14g/cm3 |
| Melting point |
149-153℃ |
| Boiling point |
417°C at 760 mmHg |
| Refractive index |
1.703 |
| Flash point |
192.1°C |
| Vapour Pressur |
8.86E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
